C10H14FN3O — CID 63978211
N-(4-aminobutyl)-6-fluoropyridine-3-carboxamide (PubChem CID 63978211) has the molecular formula C10H14FN3O and a molecular weight of 211.24 g/mol. Its IUPAC name is N-(4-aminobutyl)-6-fluoropyridine-3-carboxamide.
| Compound Name | N-(4-aminobutyl)-6-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 63978211 |
| Molecular Formula | C10H14FN3O |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | N-(4-aminobutyl)-6-fluoropyridine-3-carboxamide |
| SMILES | NCCCCNC(=O)c1ccc(F)nc1 |
| InChI | InChI=1S/C10H14FN3O/c11-9-4-3-8(7-14-9)10(15)13-6-2-1-5-12/h3-4,7H,1-2,5-6,12H2,(H,13,15) |
| InChIKey | CLZOWVZZQPZRKT-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|