C11H16N4O2 — CID 135503305
N-(4-aminobutyl)-6-(hydroxyiminomethyl)pyridine-3-carboxamide (PubChem CID 135503305) has the molecular formula C11H16N4O2 and a molecular weight of 236.28 g/mol. Its IUPAC name is N-(4-aminobutyl)-6-(hydroxyiminomethyl)pyridine-3-carboxamide.
| Compound Name | N-(4-aminobutyl)-6-(hydroxyiminomethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135503305 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N-(4-aminobutyl)-6-(hydroxyiminomethyl)pyridine-3-carboxamide |
| SMILES | NCCCCNC(=O)c1ccc(C=NO)nc1 |
| InChI | InChI=1S/C11H16N4O2/c12-5-1-2-6-13-11(16)9-3-4-10(8-15-17)14-7-9/h3-4,7-8,17H,1-2,5-6,12H2,(H,13,16) |
| InChIKey | YQTHLMITLQODPU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|