C9H12N4O2 — CID 135495466
N-(2-aminoethyl)-6-[(E)-hydroxyiminomethyl]pyridine-3-carboxamide (PubChem CID 135495466) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is N-(2-aminoethyl)-6-[(E)-hydroxyiminomethyl]pyridine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-6-[(E)-hydroxyiminomethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135495466 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N-(2-aminoethyl)-6-[(E)-hydroxyiminomethyl]pyridine-3-carboxamide |
| SMILES | NCCNC(=O)c1ccc(/C=N/O)nc1 |
| InChI | InChI=1S/C9H12N4O2/c10-3-4-11-9(14)7-1-2-8(6-13-15)12-5-7/h1-2,5-6,15H,3-4,10H2,(H,11,14)/b13-6+ |
| InChIKey | RRUSXBOQIJNRSY-AWNIVKPZSA-N |
| XLogP | -0.42 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|