C15H15N5O3 — CID 135644447
6-[(E)-hydroxyiminomethyl]-N-[2-(pyridine-4-carbonylamino)ethyl]pyridine-3-carboxamide (PubChem CID 135644447) has the molecular formula C15H15N5O3 and a molecular weight of 313.32 g/mol. Its IUPAC name is 6-[(E)-hydroxyiminomethyl]-N-[2-(pyridine-4-carbonylamino)ethyl]pyridine-3-carboxamide.
| Compound Name | 6-[(E)-hydroxyiminomethyl]-N-[2-(pyridine-4-carbonylamino)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135644447 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 6-[(E)-hydroxyiminomethyl]-N-[2-(pyridine-4-carbonylamino)ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCNC(=O)c1ccc(/C=N/O)nc1)c1ccncc1 |
| InChI | InChI=1S/C15H15N5O3/c21-14(11-3-5-16-6-4-11)17-7-8-18-15(22)12-1-2-13(10-20-23)19-9-12/h1-6,9-10,23H,7-8H2,(H,17,21)(H,18,22)/b20-10+ |
| InChIKey | QXSRSUBAXXKXOJ-KEBDBYFISA-N |
| XLogP | 0.44 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|