C11H16N4O3 — CID 136801858
N-[2-(2-hydroxyethylamino)ethyl]-6-[(Z)-hydroxyiminomethyl]pyridine-3-carboxamide (PubChem CID 136801858) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is N-[2-(2-hydroxyethylamino)ethyl]-6-[(Z)-hydroxyiminomethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-(2-hydroxyethylamino)ethyl]-6-[(Z)-hydroxyiminomethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 136801858 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | N-[2-(2-hydroxyethylamino)ethyl]-6-[(Z)-hydroxyiminomethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCNCCO)c1ccc(/C=N\O)nc1 |
| InChI | InChI=1S/C11H16N4O3/c16-6-5-12-3-4-13-11(17)9-1-2-10(8-15-18)14-7-9/h1-2,7-8,12,16,18H,3-6H2,(H,13,17)/b15-8- |
| InChIKey | IHWJAJROHQDHOV-NVNXTCNLSA-N |
| XLogP | -0.80 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|