C10H14N2O2 — CID 43417610
N-(3-hydroxypropyl)-6-methylpyridine-3-carboxamide (PubChem CID 43417610) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-6-methylpyridine-3-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 43417610 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | N-(3-hydroxypropyl)-6-methylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCCO)cn1 |
| InChI | InChI=1S/C10H14N2O2/c1-8-3-4-9(7-12-8)10(14)11-5-2-6-13/h3-4,7,13H,2,5-6H2,1H3,(H,11,14) |
| InChIKey | FTMKYZBKQCFEIE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|