C9H9F3N2O — CID 10013611
6-methyl-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide (PubChem CID 10013611) has the molecular formula C9H9F3N2O and a molecular weight of 218.18 g/mol. Its IUPAC name is 6-methyl-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide.
| Compound Name | 6-methyl-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10013611 |
| Molecular Formula | C9H9F3N2O |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 6-methyl-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NCC(F)(F)F)cn1 |
| InChI | InChI=1S/C9H9F3N2O/c1-6-2-3-7(4-13-6)8(15)14-5-9(10,11)12/h2-4H,5H2,1H3,(H,14,15) |
| InChIKey | QAJNANQELAYNQX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |