C14H22F3NO — CID 145192130
ethane;4-methyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 145192130) has the molecular formula C14H22F3NO and a molecular weight of 277.33 g/mol. Its IUPAC name is ethane;4-methyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | ethane;4-methyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 145192130 |
| Molecular Formula | C14H22F3NO |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | ethane;4-methyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CC.CC.Cc1ccc(C(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F3NO.2C2H6/c1-7-2-4-8(5-3-7)9(15)14-6-10(11,12)13;2*1-2/h2-5H,6H2,1H3,(H,14,15);2*1-2H3 |
| InChIKey | AEPJAWMCPXAYLV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |