C11H12F3NO — CID 78785997
2,4-dimethyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 78785997) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is 2,4-dimethyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2,4-dimethyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 78785997 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2,4-dimethyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | Cc1ccc(C(=O)NCC(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C11H12F3NO/c1-7-3-4-9(8(2)5-7)10(16)15-6-11(12,13)14/h3-5H,6H2,1-2H3,(H,15,16) |
| InChIKey | AHOPVERQXMKVSA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |