C10H12F3N3O — CID 62509922
2-hydrazinyl-5-methyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 62509922) has the molecular formula C10H12F3N3O and a molecular weight of 247.22 g/mol. Its IUPAC name is 2-hydrazinyl-5-methyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-hydrazinyl-5-methyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 62509922 |
| Molecular Formula | C10H12F3N3O |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-hydrazinyl-5-methyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | Cc1ccc(NN)c(C(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H12F3N3O/c1-6-2-3-8(16-14)7(4-6)9(17)15-5-10(11,12)13/h2-4,16H,5,14H2,1H3,(H,15,17) |
| InChIKey | TVLRVRZOYPLLDP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|