C13H18F3N3O — CID 62511147
2-hydrazinyl-5-methyl-N-propyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 62511147) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-hydrazinyl-5-methyl-N-propyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-hydrazinyl-5-methyl-N-propyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 62511147 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-hydrazinyl-5-methyl-N-propyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCCN(CC(F)(F)F)C(=O)c1cc(C)ccc1NN |
| InChI | InChI=1S/C13H18F3N3O/c1-3-6-19(8-13(14,15)16)12(20)10-7-9(2)4-5-11(10)18-17/h4-5,7,18H,3,6,8,17H2,1-2H3 |
| InChIKey | FDHJPZDGBIHKGG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|