C12H12BrClF3NO — CID 107492061
2-bromo-N-(2-chloroethyl)-5-methyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 107492061) has the molecular formula C12H12BrClF3NO and a molecular weight of 358.59 g/mol. Its IUPAC name is 2-bromo-N-(2-chloroethyl)-5-methyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-bromo-N-(2-chloroethyl)-5-methyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 107492061 |
| Molecular Formula | C12H12BrClF3NO |
| Molecular Weight | 358.59 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | 2-bromo-N-(2-chloroethyl)-5-methyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | Cc1ccc(Br)c(C(=O)N(CCCl)CC(F)(F)F)c1 |
| InChI | InChI=1S/C12H12BrClF3NO/c1-8-2-3-10(13)9(6-8)11(19)18(5-4-14)7-12(15,16)17/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | YZFJGCKOESEJJY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|