C11H10ClF4NO2 — CID 107491968
N-(2-chloroethyl)-4-fluoro-2-hydroxy-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 107491968) has the molecular formula C11H10ClF4NO2 and a molecular weight of 299.65 g/mol. Its IUPAC name is N-(2-chloroethyl)-4-fluoro-2-hydroxy-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | N-(2-chloroethyl)-4-fluoro-2-hydroxy-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 107491968 |
| Molecular Formula | C11H10ClF4NO2 |
| Molecular Weight | 299.65 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | N-(2-chloroethyl)-4-fluoro-2-hydroxy-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(c1ccc(F)cc1O)N(CCCl)CC(F)(F)F |
| InChI | InChI=1S/C11H10ClF4NO2/c12-3-4-17(6-11(14,15)16)10(19)8-2-1-7(13)5-9(8)18/h1-2,5,18H,3-4,6H2 |
| InChIKey | NWRVENAEJLZMKI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.65 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|