C11H11BrF3NO3 — CID 107726301
N-(2-bromoethyl)-2,4-dihydroxy-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 107726301) has the molecular formula C11H11BrF3NO3 and a molecular weight of 342.11 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,4-dihydroxy-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | N-(2-bromoethyl)-2,4-dihydroxy-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 107726301 |
| Molecular Formula | C11H11BrF3NO3 |
| Molecular Weight | 342.11 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | N-(2-bromoethyl)-2,4-dihydroxy-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(c1ccc(O)cc1O)N(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C11H11BrF3NO3/c12-3-4-16(6-11(13,14)15)10(19)8-2-1-7(17)5-9(8)18/h1-2,5,17-18H,3-4,6H2 |
| InChIKey | RYDLUCPCSCEXBR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.11 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|