C11H10BrF4NO2 — CID 107492451
N-(2-bromoethyl)-2-fluoro-6-hydroxy-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 107492451) has the molecular formula C11H10BrF4NO2 and a molecular weight of 344.10 g/mol. Its IUPAC name is N-(2-bromoethyl)-2-fluoro-6-hydroxy-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | N-(2-bromoethyl)-2-fluoro-6-hydroxy-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 107492451 |
| Molecular Formula | C11H10BrF4NO2 |
| Molecular Weight | 344.10 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | N-(2-bromoethyl)-2-fluoro-6-hydroxy-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(c1c(O)cccc1F)N(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C11H10BrF4NO2/c12-4-5-17(6-11(14,15)16)10(19)9-7(13)2-1-3-8(9)18/h1-3,18H,4-6H2 |
| InChIKey | XTHOCPQYMPEBGO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.10 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|