C9H9BrF3N3O — CID 107492513
N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)pyrimidine-5-carboxamide (PubChem CID 107492513) has the molecular formula C9H9BrF3N3O and a molecular weight of 312.09 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)pyrimidine-5-carboxamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 107492513 |
| Molecular Formula | C9H9BrF3N3O |
| Molecular Weight | 312.09 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)pyrimidine-5-carboxamide |
| SMILES | O=C(c1cncnc1)N(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C9H9BrF3N3O/c10-1-2-16(5-9(11,12)13)8(17)7-3-14-6-15-4-7/h3-4,6H,1-2,5H2 |
| InChIKey | GUJSYSYCBLIONL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.09 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|