C9H7Br3F3NOS — CID 107966465
2,5-dibromo-N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)thiophene-3-carboxamide (PubChem CID 107966465) has the molecular formula C9H7Br3F3NOS and a molecular weight of 473.93 g/mol. Its IUPAC name is 2,5-dibromo-N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 107966465 |
| Molecular Formula | C9H7Br3F3NOS |
| Molecular Weight | 473.93 g/mol |
| Exact Mass | 470.78 |
| IUPAC Name | 2,5-dibromo-N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)thiophene-3-carboxamide |
| SMILES | O=C(c1cc(Br)sc1Br)N(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C9H7Br3F3NOS/c10-1-2-16(4-9(13,14)15)8(17)5-3-6(11)18-7(5)12/h3H,1-2,4H2 |
| InChIKey | IURKRAPWYMTXNQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.93 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|