C10H12Br2N2OS2 — CID 114021243
N-(2-amino-2-sulfanylideneethyl)-2,5-dibromo-N-propylthiophene-3-carboxamide (PubChem CID 114021243) has the molecular formula C10H12Br2N2OS2 and a molecular weight of 400.16 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-2,5-dibromo-N-propylthiophene-3-carboxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-2,5-dibromo-N-propylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 114021243 |
| Molecular Formula | C10H12Br2N2OS2 |
| Molecular Weight | 400.16 g/mol |
| Exact Mass | 397.88 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-2,5-dibromo-N-propylthiophene-3-carboxamide |
| SMILES | CCCN(CC(N)=S)C(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C10H12Br2N2OS2/c1-2-3-14(5-8(13)16)10(15)6-4-7(11)17-9(6)12/h4H,2-3,5H2,1H3,(H2,13,16) |
| InChIKey | KHTJVIYNKRIUPF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.16 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|