C9H11Br2NOS — CID 103672324
2,5-dibromo-N,N-diethylthiophene-3-carboxamide (PubChem CID 103672324) has the molecular formula C9H11Br2NOS and a molecular weight of 341.07 g/mol. Its IUPAC name is 2,5-dibromo-N,N-diethylthiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N,N-diethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 103672324 |
| Molecular Formula | C9H11Br2NOS |
| Molecular Weight | 341.07 g/mol |
| Exact Mass | 338.89 |
| IUPAC Name | 2,5-dibromo-N,N-diethylthiophene-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H11Br2NOS/c1-3-12(4-2)9(13)6-5-7(10)14-8(6)11/h5H,3-4H2,1-2H3 |
| InChIKey | INNBCPHTFCGVKS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.07 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |