C9H10Br2ClNOS — CID 107965873
2,5-dibromo-N-(2-chloropropyl)-N-methylthiophene-3-carboxamide (PubChem CID 107965873) has the molecular formula C9H10Br2ClNOS and a molecular weight of 375.51 g/mol. Its IUPAC name is 2,5-dibromo-N-(2-chloropropyl)-N-methylthiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-(2-chloropropyl)-N-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 107965873 |
| Molecular Formula | C9H10Br2ClNOS |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 372.85 |
| IUPAC Name | 2,5-dibromo-N-(2-chloropropyl)-N-methylthiophene-3-carboxamide |
| SMILES | CC(Cl)CN(C)C(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H10Br2ClNOS/c1-5(12)4-13(2)9(14)6-3-7(10)15-8(6)11/h3,5H,4H2,1-2H3 |
| InChIKey | GGTQGBVLJQRIAQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|