C11H16ClNOS — CID 65238122
N-(2-chloropropyl)-N,4,5-trimethylthiophene-2-carboxamide (PubChem CID 65238122) has the molecular formula C11H16ClNOS and a molecular weight of 245.77 g/mol. Its IUPAC name is N-(2-chloropropyl)-N,4,5-trimethylthiophene-2-carboxamide.
| Compound Name | N-(2-chloropropyl)-N,4,5-trimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 65238122 |
| Molecular Formula | C11H16ClNOS |
| Molecular Weight | 245.77 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | N-(2-chloropropyl)-N,4,5-trimethylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)CC(C)Cl)sc1C |
| InChI | InChI=1S/C11H16ClNOS/c1-7-5-10(15-9(7)3)11(14)13(4)6-8(2)12/h5,8H,6H2,1-4H3 |
| InChIKey | IPTBROUZLREUPC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.77 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|