C12H16ClNO — CID 63393760
N-(2-chloropropyl)-N,3-dimethylbenzamide (PubChem CID 63393760) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is N-(2-chloropropyl)-N,3-dimethylbenzamide.
| Compound Name | N-(2-chloropropyl)-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 63393760 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | N-(2-chloropropyl)-N,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)N(C)CC(C)Cl)c1 |
| InChI | InChI=1S/C12H16ClNO/c1-9-5-4-6-11(7-9)12(15)14(3)8-10(2)13/h4-7,10H,8H2,1-3H3 |
| InChIKey | JDJQYSVBXNBQAF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|