C19H19Cl2NO2 — CID 54275892
N-[(2S)-2-(3,4-dichlorophenyl)-4-oxobutyl]-N,3-dimethylbenzamide (PubChem CID 54275892) has the molecular formula C19H19Cl2NO2 and a molecular weight of 364.27 g/mol. Its IUPAC name is N-[(2S)-2-(3,4-dichlorophenyl)-4-oxobutyl]-N,3-dimethylbenzamide.
| Compound Name | N-[(2S)-2-(3,4-dichlorophenyl)-4-oxobutyl]-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 54275892 |
| Molecular Formula | C19H19Cl2NO2 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | N-[(2S)-2-(3,4-dichlorophenyl)-4-oxobutyl]-N,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)N(C)C[C@@H](CC=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C19H19Cl2NO2/c1-13-4-3-5-15(10-13)19(24)22(2)12-16(8-9-23)14-6-7-17(20)18(21)11-14/h3-7,9-11,16H,8,12H2,1-2H3/t16-/m1/s1 |
| InChIKey | RNJUJLYIPKCUBI-MRXNPFEDSA-N |
| XLogP | 4.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|