C18H15Cl4NO2 — CID 54492746
3,5-dichloro-N-[(2S)-2-(3,4-dichlorophenyl)-4-oxobutyl]-N-methylbenzamide (PubChem CID 54492746) has the molecular formula C18H15Cl4NO2 and a molecular weight of 419.14 g/mol. Its IUPAC name is 3,5-dichloro-N-[(2S)-2-(3,4-dichlorophenyl)-4-oxobutyl]-N-methylbenzamide.
| Compound Name | 3,5-dichloro-N-[(2S)-2-(3,4-dichlorophenyl)-4-oxobutyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 54492746 |
| Molecular Formula | C18H15Cl4NO2 |
| Molecular Weight | 419.14 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | 3,5-dichloro-N-[(2S)-2-(3,4-dichlorophenyl)-4-oxobutyl]-N-methylbenzamide |
| SMILES | CN(C[C@@H](CC=O)c1ccc(Cl)c(Cl)c1)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H15Cl4NO2/c1-23(18(25)13-6-14(19)9-15(20)7-13)10-12(4-5-24)11-2-3-16(21)17(22)8-11/h2-3,5-9,12H,4,10H2,1H3/t12-/m1/s1 |
| InChIKey | XWXGQWDCEWUQFH-GFCCVEGCSA-N |
| XLogP | 5.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.14 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|