C21H17Cl2F6NO — CID 56976945
N-[(2S)-2-(3,4-dichlorophenyl)pent-4-enyl]-N-methyl-3,5-bis(trifluoromethyl)benzamide (PubChem CID 56976945) has the molecular formula C21H17Cl2F6NO and a molecular weight of 484.27 g/mol. Its IUPAC name is N-[(2S)-2-(3,4-dichlorophenyl)pent-4-enyl]-N-methyl-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(2S)-2-(3,4-dichlorophenyl)pent-4-enyl]-N-methyl-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 56976945 |
| Molecular Formula | C21H17Cl2F6NO |
| Molecular Weight | 484.27 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | N-[(2S)-2-(3,4-dichlorophenyl)pent-4-enyl]-N-methyl-3,5-bis(trifluoromethyl)benzamide |
| SMILES | C=CC[C@H](CN(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H17Cl2F6NO/c1-3-4-13(12-5-6-17(22)18(23)9-12)11-30(2)19(31)14-7-15(20(24,25)26)10-16(8-14)21(27,28)29/h3,5-10,13H,1,4,11H2,2H3/t13-/m1/s1 |
| InChIKey | FVCKYWNNPWADGF-CYBMUJFWSA-N |
| XLogP | 7.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.27 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|