C21H23F6NO2Si — CID 526019
N-methyl-N-(2-phenyl-2-trimethylsilyloxyethyl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 526019) has the molecular formula C21H23F6NO2Si and a molecular weight of 463.49 g/mol. Its IUPAC name is N-methyl-N-(2-phenyl-2-trimethylsilyloxyethyl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-methyl-N-(2-phenyl-2-trimethylsilyloxyethyl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 526019 |
| Molecular Formula | C21H23F6NO2Si |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | N-methyl-N-(2-phenyl-2-trimethylsilyloxyethyl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CN(CC(O[Si](C)(C)C)c1ccccc1)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H23F6NO2Si/c1-28(13-18(30-31(2,3)4)14-8-6-5-7-9-14)19(29)15-10-16(20(22,23)24)12-17(11-15)21(25,26)27/h5-12,18H,13H2,1-4H3 |
| InChIKey | CKJMVNRUFSZQOO-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|