C16H20F6N2O — CID 119659005
N-(3-amino-4-methylpentyl)-N-methyl-3,5-bis(trifluoromethyl)benzamide (PubChem CID 119659005) has the molecular formula C16H20F6N2O and a molecular weight of 370.34 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-N-methyl-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(3-amino-4-methylpentyl)-N-methyl-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 119659005 |
| Molecular Formula | C16H20F6N2O |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-N-methyl-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CC(C)C(N)CCN(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H20F6N2O/c1-9(2)13(23)4-5-24(3)14(25)10-6-11(15(17,18)19)8-12(7-10)16(20,21)22/h6-9,13H,4-5,23H2,1-3H3 |
| InChIKey | BCNVNKDNHMLLQU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |