C15H23ClN2O — CID 115317476
N-(3-amino-4-methylpentyl)-3-chloro-N,5-dimethylbenzamide (PubChem CID 115317476) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-3-chloro-N,5-dimethylbenzamide.
| Compound Name | N-(3-amino-4-methylpentyl)-3-chloro-N,5-dimethylbenzamide |
|---|---|
| PubChem CID | 115317476 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-3-chloro-N,5-dimethylbenzamide |
| SMILES | Cc1cc(Cl)cc(C(=O)N(C)CCC(N)C(C)C)c1 |
| InChI | InChI=1S/C15H23ClN2O/c1-10(2)14(17)5-6-18(4)15(19)12-7-11(3)8-13(16)9-12/h7-10,14H,5-6,17H2,1-4H3 |
| InChIKey | ZCVSJXRIKKIZMM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |