C17H26ClN3O4 — CID 119660135
N-(3-amino-4-methylpentyl)-4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-methylbenzamide (PubChem CID 119660135) has the molecular formula C17H26ClN3O4 and a molecular weight of 371.87 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-methylbenzamide.
| Compound Name | N-(3-amino-4-methylpentyl)-4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 119660135 |
| Molecular Formula | C17H26ClN3O4 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-methylbenzamide |
| SMILES | COc1cc(C(=O)N(C)CCC(N)C(C)C)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C17H26ClN3O4/c1-10(2)13(19)5-6-21(3)17(23)11-7-12(18)16(14(8-11)24-4)25-9-15(20)22/h7-8,10,13H,5-6,9,19H2,1-4H3,(H2,20,22) |
| InChIKey | VFGKOLIJLRRDDA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |