C15H23NO5 — CID 115673500
N-(3-hydroxybutyl)-3,4,5-trimethoxy-N-methylbenzamide (PubChem CID 115673500) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-3,4,5-trimethoxy-N-methylbenzamide.
| Compound Name | N-(3-hydroxybutyl)-3,4,5-trimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 115673500 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-(3-hydroxybutyl)-3,4,5-trimethoxy-N-methylbenzamide |
| SMILES | COc1cc(C(=O)N(C)CCC(C)O)cc(OC)c1OC |
| InChI | InChI=1S/C15H23NO5/c1-10(17)6-7-16(2)15(18)11-8-12(19-3)14(21-5)13(9-11)20-4/h8-10,17H,6-7H2,1-5H3 |
| InChIKey | PZESQGCOFZKXJD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |