C18H21NO4 — CID 669607
N-benzyl-3,4,5-trimethoxy-N-methylbenzamide (PubChem CID 669607) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-benzyl-3,4,5-trimethoxy-N-methylbenzamide.
| Compound Name | N-benzyl-3,4,5-trimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 669607 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-benzyl-3,4,5-trimethoxy-N-methylbenzamide |
| SMILES | COc1cc(C(=O)N(C)Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H21NO4/c1-19(12-13-8-6-5-7-9-13)18(20)14-10-15(21-2)17(23-4)16(11-14)22-3/h5-11H,12H2,1-4H3 |
| InChIKey | ZXDSIWWBBCROER-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |