C21H25NO6 — CID 71905565
methyl (2S)-2-[benzyl-(3,4,5-trimethoxybenzoyl)amino]propanoate (PubChem CID 71905565) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is methyl (2S)-2-[benzyl-(3,4,5-trimethoxybenzoyl)amino]propanoate.
| Compound Name | methyl (2S)-2-[benzyl-(3,4,5-trimethoxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 71905565 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | methyl (2S)-2-[benzyl-(3,4,5-trimethoxybenzoyl)amino]propanoate |
| SMILES | COC(=O)[C@H](C)N(Cc1ccccc1)C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H25NO6/c1-14(21(24)28-5)22(13-15-9-7-6-8-10-15)20(23)16-11-17(25-2)19(27-4)18(12-16)26-3/h6-12,14H,13H2,1-5H3/t14-/m0/s1 |
| InChIKey | BUUAQJMFPFHUED-AWEZNQCLSA-N |
| XLogP | 2.92 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |