C27H29NO5 — CID 986606
(2S)-N,N-dibenzyl-2-methyl-3-oxo-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 986606) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is (2S)-N,N-dibenzyl-2-methyl-3-oxo-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | (2S)-N,N-dibenzyl-2-methyl-3-oxo-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 986606 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (2S)-N,N-dibenzyl-2-methyl-3-oxo-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(C(=O)[C@H](C)C(=O)N(Cc2ccccc2)Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H29NO5/c1-19(25(29)22-15-23(31-2)26(33-4)24(16-22)32-3)27(30)28(17-20-11-7-5-8-12-20)18-21-13-9-6-10-14-21/h5-16,19H,17-18H2,1-4H3/t19-/m0/s1 |
| InChIKey | KDYXJDDIUNBTAS-IBGZPJMESA-N |
| XLogP | 4.76 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|