C24H25NO3 — CID 40742883
(2S)-N,N-dibenzyl-2-(2-methoxyphenoxy)propanamide (PubChem CID 40742883) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2S)-N,N-dibenzyl-2-(2-methoxyphenoxy)propanamide.
| Compound Name | (2S)-N,N-dibenzyl-2-(2-methoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 40742883 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (2S)-N,N-dibenzyl-2-(2-methoxyphenoxy)propanamide |
| SMILES | COc1ccccc1O[C@@H](C)C(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H25NO3/c1-19(28-23-16-10-9-15-22(23)27-2)24(26)25(17-20-11-5-3-6-12-20)18-21-13-7-4-8-14-21/h3-16,19H,17-18H2,1-2H3/t19-/m0/s1 |
| InChIKey | JFFUWVNWKRPIDA-IBGZPJMESA-N |
| XLogP | 4.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |