C27H29NO5 — CID 31883866
[(2R)-1-(dibenzylamino)-1-oxopropan-2-yl] 2-(2,4-dimethoxyphenyl)acetate (PubChem CID 31883866) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is [(2R)-1-(dibenzylamino)-1-oxopropan-2-yl] 2-(2,4-dimethoxyphenyl)acetate.
| Compound Name | [(2R)-1-(dibenzylamino)-1-oxopropan-2-yl] 2-(2,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 31883866 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | [(2R)-1-(dibenzylamino)-1-oxopropan-2-yl] 2-(2,4-dimethoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)O[C@H](C)C(=O)N(Cc2ccccc2)Cc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C27H29NO5/c1-20(33-26(29)16-23-14-15-24(31-2)17-25(23)32-3)27(30)28(18-21-10-6-4-7-11-21)19-22-12-8-5-9-13-22/h4-15,17,20H,16,18-19H2,1-3H3/t20-/m1/s1 |
| InChIKey | NLRWKTPQVIWMGZ-HXUWFJFHSA-N |
| XLogP | 4.41 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |