C27H29NO6 — CID 2572185
[(2S)-1-(dibenzylamino)-1-oxopropan-2-yl] 3,4,5-trimethoxybenzoate (PubChem CID 2572185) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is [(2S)-1-(dibenzylamino)-1-oxopropan-2-yl] 3,4,5-trimethoxybenzoate.
| Compound Name | [(2S)-1-(dibenzylamino)-1-oxopropan-2-yl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 2572185 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | [(2S)-1-(dibenzylamino)-1-oxopropan-2-yl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)O[C@@H](C)C(=O)N(Cc2ccccc2)Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H29NO6/c1-19(34-27(30)22-15-23(31-2)25(33-4)24(16-22)32-3)26(29)28(17-20-11-7-5-8-12-20)18-21-13-9-6-10-14-21/h5-16,19H,17-18H2,1-4H3/t19-/m0/s1 |
| InChIKey | IEJICXABQAMKDT-IBGZPJMESA-N |
| XLogP | 4.49 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |