C25H26N2O5S — CID 2607540
[(2R)-1-(dibenzylamino)-1-oxopropan-2-yl] 3-(methylsulfamoyl)benzoate (PubChem CID 2607540) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is [(2R)-1-(dibenzylamino)-1-oxopropan-2-yl] 3-(methylsulfamoyl)benzoate.
| Compound Name | [(2R)-1-(dibenzylamino)-1-oxopropan-2-yl] 3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2607540 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | [(2R)-1-(dibenzylamino)-1-oxopropan-2-yl] 3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)O[C@H](C)C(=O)N(Cc2ccccc2)Cc2ccccc2)c1 |
| InChI | InChI=1S/C25H26N2O5S/c1-19(32-25(29)22-14-9-15-23(16-22)33(30,31)26-2)24(28)27(17-20-10-5-3-6-11-20)18-21-12-7-4-8-13-21/h3-16,19,26H,17-18H2,1-2H3/t19-/m1/s1 |
| InChIKey | MZSYPBZNCGHVMJ-LJQANCHMSA-N |
| XLogP | 3.37 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |