C26H26N2O4 — CID 42972459
[1-(dibenzylamino)-1-oxopropan-2-yl] 3-acetamidobenzoate (PubChem CID 42972459) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is [1-(dibenzylamino)-1-oxopropan-2-yl] 3-acetamidobenzoate.
| Compound Name | [1-(dibenzylamino)-1-oxopropan-2-yl] 3-acetamidobenzoate |
|---|---|
| PubChem CID | 42972459 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | [1-(dibenzylamino)-1-oxopropan-2-yl] 3-acetamidobenzoate |
| SMILES | CC(=O)Nc1cccc(C(=O)OC(C)C(=O)N(Cc2ccccc2)Cc2ccccc2)c1 |
| InChI | InChI=1S/C26H26N2O4/c1-19(32-26(31)23-14-9-15-24(16-23)27-20(2)29)25(30)28(17-21-10-5-3-6-11-21)18-22-12-7-4-8-13-22/h3-16,19H,17-18H2,1-2H3,(H,27,29) |
| InChIKey | APWSIRFVHLOXPH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |