C21H28N2O5S — CID 9320471
[(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 3-(methylsulfamoyl)benzoate (PubChem CID 9320471) has the molecular formula C21H28N2O5S and a molecular weight of 420.53 g/mol. Its IUPAC name is [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 3-(methylsulfamoyl)benzoate.
| Compound Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 9320471 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)O[C@@H](C)C(=O)NC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C21H28N2O5S/c1-13(28-20(25)17-4-3-5-18(9-17)29(26,27)22-2)19(24)23-21-10-14-6-15(11-21)8-16(7-14)12-21/h3-5,9,13-16,22H,6-8,10-12H2,1-2H3,(H,23,24)/t13-,14?,15?,16?,21?/m0/s1 |
| InChIKey | RUKQZYMBMIZSRL-JHMRYYBSSA-N |
| XLogP | 2.22 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |