C20H24FNO3 — CID 7789451
[(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 4-fluorobenzoate (PubChem CID 7789451) has the molecular formula C20H24FNO3 and a molecular weight of 345.41 g/mol. Its IUPAC name is [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 4-fluorobenzoate.
| Compound Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 7789451 |
| Molecular Formula | C20H24FNO3 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 4-fluorobenzoate |
| SMILES | C[C@H](OC(=O)c1ccc(F)cc1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H24FNO3/c1-12(25-19(24)16-2-4-17(21)5-3-16)18(23)22-20-9-13-6-14(10-20)8-15(7-13)11-20/h2-5,12-15H,6-11H2,1H3,(H,22,23)/t12-,13?,14?,15?,20?/m0/s1 |
| InChIKey | XPQKUCFBBZQOAM-PGBBXINNSA-N |
| XLogP | 3.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |