C22H27FN2O4 — CID 8662682
[(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-[(3-fluorobenzoyl)amino]acetate (PubChem CID 8662682) has the molecular formula C22H27FN2O4 and a molecular weight of 402.47 g/mol. Its IUPAC name is [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-[(3-fluorobenzoyl)amino]acetate.
| Compound Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-[(3-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 8662682 |
| Molecular Formula | C22H27FN2O4 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-[(3-fluorobenzoyl)amino]acetate |
| SMILES | C[C@@H](OC(=O)CNC(=O)c1cccc(F)c1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H27FN2O4/c1-13(29-19(26)12-24-21(28)17-3-2-4-18(23)8-17)20(27)25-22-9-14-5-15(10-22)7-16(6-14)11-22/h2-4,8,13-16H,5-7,9-12H2,1H3,(H,24,28)(H,25,27)/t13-,14?,15?,16?,22?/m1/s1 |
| InChIKey | AHTQVZSCUJWYML-ZHHULCEESA-N |
| XLogP | 2.57 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |