C21H27NO3 — CID 42902130
[1-(1-adamantylamino)-1-oxopropan-2-yl] 2-phenylacetate (PubChem CID 42902130) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is [1-(1-adamantylamino)-1-oxopropan-2-yl] 2-phenylacetate.
| Compound Name | [1-(1-adamantylamino)-1-oxopropan-2-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 42902130 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | [1-(1-adamantylamino)-1-oxopropan-2-yl] 2-phenylacetate |
| SMILES | CC(OC(=O)Cc1ccccc1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H27NO3/c1-14(25-19(23)10-15-5-3-2-4-6-15)20(24)22-21-11-16-7-17(12-21)9-18(8-16)13-21/h2-6,14,16-18H,7-13H2,1H3,(H,22,24) |
| InChIKey | IBAKWIAPHCULKZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |