C23H28N2O3 — CID 7960224
[(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate (PubChem CID 7960224) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 7960224 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate |
| SMILES | C[C@@H](OC(=O)Cc1c[nH]c2ccccc12)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H28N2O3/c1-14(28-21(26)9-18-13-24-20-5-3-2-4-19(18)20)22(27)25-23-10-15-6-16(11-23)8-17(7-15)12-23/h2-5,13-17,24H,6-12H2,1H3,(H,25,27)/t14-,15?,16?,17?,23?/m1/s1 |
| InChIKey | YPOLWRPKHJYJRX-KWJFTMPMSA-N |
| XLogP | 3.73 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |