C18H22N2O3 — CID 7259091
[(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate (PubChem CID 7259091) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 7259091 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate |
| SMILES | C[C@@H](OC(=O)Cc1c[nH]c2ccccc12)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C18H22N2O3/c1-12(18(22)20-14-6-2-3-7-14)23-17(21)10-13-11-19-16-9-5-4-8-15(13)16/h4-5,8-9,11-12,14,19H,2-3,6-7,10H2,1H3,(H,20,22)/t12-/m1/s1 |
| InChIKey | OOSKMRFPQNBYHH-GFCCVEGCSA-N |
| XLogP | 2.70 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |