C18H23N3O3 — CID 175275526
[1-(cyclohexylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl] carbamate (PubChem CID 175275526) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is [1-(cyclohexylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl] carbamate.
| Compound Name | [1-(cyclohexylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl] carbamate |
|---|---|
| PubChem CID | 175275526 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | [1-(cyclohexylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl] carbamate |
| SMILES | NC(=O)OC(Cc1c[nH]c2ccccc12)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H23N3O3/c19-18(23)24-16(17(22)21-13-6-2-1-3-7-13)10-12-11-20-15-9-5-4-8-14(12)15/h4-5,8-9,11,13,16,20H,1-3,6-7,10H2,(H2,19,23)(H,21,22) |
| InChIKey | UWMYJPXQCLXWJS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |