C16H21N3O — CID 91153843
(2S)-2-(cyclopentylamino)-3-(1H-indol-3-yl)propanamide (PubChem CID 91153843) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is (2S)-2-(cyclopentylamino)-3-(1H-indol-3-yl)propanamide.
| Compound Name | (2S)-2-(cyclopentylamino)-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 91153843 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | (2S)-2-(cyclopentylamino)-3-(1H-indol-3-yl)propanamide |
| SMILES | NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC1CCCC1 |
| InChI | InChI=1S/C16H21N3O/c17-16(20)15(19-12-5-1-2-6-12)9-11-10-18-14-8-4-3-7-13(11)14/h3-4,7-8,10,12,15,18-19H,1-2,5-6,9H2,(H2,17,20)/t15-/m0/s1 |
| InChIKey | IYUJJRXGJHESRR-HNNXBMFYSA-N |
| XLogP | 2.10 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |