C18H25N3O3 — CID 175552962
[(1R)-1-(cyclohexylamino)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl] carbamate (PubChem CID 175552962) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is [(1R)-1-(cyclohexylamino)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl] carbamate.
| Compound Name | [(1R)-1-(cyclohexylamino)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl] carbamate |
|---|---|
| PubChem CID | 175552962 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | [(1R)-1-(cyclohexylamino)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl] carbamate |
| SMILES | NC(=O)OC(Cc1c[nH]c2ccccc12)[C@@H](O)NC1CCCCC1 |
| InChI | InChI=1S/C18H25N3O3/c19-18(23)24-16(17(22)21-13-6-2-1-3-7-13)10-12-11-20-15-9-5-4-8-14(12)15/h4-5,8-9,11,13,16-17,20-22H,1-3,6-7,10H2,(H2,19,23)/t16?,17-/m1/s1 |
| InChIKey | JCXVCUSRRDOMSR-ZYMOGRSISA-N |
| XLogP | 2.41 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|