C21H27N3O4 — CID 18105767
methyl (2R)-2-[[2-(cyclohexanecarbonylamino)acetyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 18105767) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is methyl (2R)-2-[[2-(cyclohexanecarbonylamino)acetyl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl (2R)-2-[[2-(cyclohexanecarbonylamino)acetyl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 18105767 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | methyl (2R)-2-[[2-(cyclohexanecarbonylamino)acetyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C21H27N3O4/c1-28-21(27)18(11-15-12-22-17-10-6-5-9-16(15)17)24-19(25)13-23-20(26)14-7-3-2-4-8-14/h5-6,9-10,12,14,18,22H,2-4,7-8,11,13H2,1H3,(H,23,26)(H,24,25)/t18-/m1/s1 |
| InChIKey | BLHBBQXKLJXXES-GOSISDBHSA-N |
| XLogP | 2.06 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |