C25H35N3O4 — CID 86873968
methyl 2-[[2-(4-cyclohexyloxypiperidin-1-yl)acetyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 86873968) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is methyl 2-[[2-(4-cyclohexyloxypiperidin-1-yl)acetyl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl 2-[[2-(4-cyclohexyloxypiperidin-1-yl)acetyl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 86873968 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | methyl 2-[[2-(4-cyclohexyloxypiperidin-1-yl)acetyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)CN1CCC(OC2CCCCC2)CC1 |
| InChI | InChI=1S/C25H35N3O4/c1-31-25(30)23(15-18-16-26-22-10-6-5-9-21(18)22)27-24(29)17-28-13-11-20(12-14-28)32-19-7-3-2-4-8-19/h5-6,9-10,16,19-20,23,26H,2-4,7-8,11-15,17H2,1H3,(H,27,29) |
| InChIKey | DDYKMFXXNKHXMV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |