C20H19ClN2O3 — CID 40819780
methyl (2S)-2-[[2-(4-chlorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 40819780) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(4-chlorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl (2S)-2-[[2-(4-chlorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 40819780 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | methyl (2S)-2-[[2-(4-chlorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClN2O3/c1-26-20(25)18(11-14-12-22-17-5-3-2-4-16(14)17)23-19(24)10-13-6-8-15(21)9-7-13/h2-9,12,18,22H,10-11H2,1H3,(H,23,24)/t18-/m0/s1 |
| InChIKey | UDCKKPURHDUMRL-SFHVURJKSA-N |
| XLogP | 3.26 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |